C22H24N2O3S — CID 161335777
N-(1,7-dimethyl-3H-inden-4-yl)-3-isocyano-4-(3-methoxypropyl)benzenesulfonamide (PubChem CID 161335777) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is N-(1,7-dimethyl-3H-inden-4-yl)-3-isocyano-4-(3-methoxypropyl)benzenesulfonamide.
| Compound Name | N-(1,7-dimethyl-3H-inden-4-yl)-3-isocyano-4-(3-methoxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 161335777 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-(1,7-dimethyl-3H-inden-4-yl)-3-isocyano-4-(3-methoxypropyl)benzenesulfonamide |
| SMILES | [C-]#[N+]c1cc(S(=O)(=O)Nc2ccc(C)c3c2CC=C3C)ccc1CCCOC |
| InChI | InChI=1S/C22H24N2O3S/c1-15-7-11-19-20(12-8-16(2)22(15)19)24-28(25,26)18-10-9-17(6-5-13-27-4)21(14-18)23-3/h7-10,12,14,24H,5-6,11,13H2,1-2,4H3 |
| InChIKey | QYOIXHMMBFJAFK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|