C9H17F3N2O3S — CID 159879008
butane-1-sulfonic acid;fluoroform;2-methyl-1H-imidazole (PubChem CID 159879008) has the molecular formula C9H17F3N2O3S and a molecular weight of 290.31 g/mol. Its IUPAC name is butane-1-sulfonic acid;fluoroform;2-methyl-1H-imidazole.
| Compound Name | butane-1-sulfonic acid;fluoroform;2-methyl-1H-imidazole |
|---|---|
| PubChem CID | 159879008 |
| Molecular Formula | C9H17F3N2O3S |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | butane-1-sulfonic acid;fluoroform;2-methyl-1H-imidazole |
| SMILES | CCCCS(=O)(=O)O.Cc1ncc[nH]1.FC(F)F |
| InChI | InChI=1S/C4H6N2.C4H10O3S.CHF3/c1-4-5-2-3-6-4;1-2-3-4-8(5,6)7;2-1(3)4/h2-3H,1H3,(H,5,6);2-4H2,1H3,(H,5,6,7);1H |
| InChIKey | NTHCXGAFIZWVTC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|