C61H67BN8O7 — CID 159880774
CID 159880774 (PubChem CID 159880774) has the molecular formula C61H67BN8O7 and a molecular weight of 1035.07 g/mol.
| Compound Name | CID 159880774 |
|---|---|
| PubChem CID | 159880774 |
| Molecular Formula | C61H67BN8O7 |
| Molecular Weight | 1035.07 g/mol |
| Exact Mass | 1034.52 |
| IUPAC Name | — |
| SMILES | N/C(=N\Cc1cccc(NC(=O)C(Cc2ccccc2)c2ccccc2)c1)NC(=O)NCC1CCCO1.[B]C(=O)N/C(CC(=O)CCC1CCCO1)=N/Cc1cccc(NC(=O)C(Cc2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C32H34BN3O4.C29H33N5O3/c33-32(39)36-30(21-27(37)16-17-28-15-8-18-40-28)34-22-24-11-7-14-26(19-24)35-31(38)29(25-12-5-2-6-13-25)20-23-9-3-1-4-10-23;30-28(34-29(36)32-20-25-15-8-16-37-25)31-19-22-11-7-14-24(17-22)33-27(35)26(23-12-5-2-6-13-23)18-21-9-3-1-4-10-21/h1-7,9-14,19,28-29H,8,15-18,20-22H2,(H,35,38)(H,34,36,39);1-7,9-14,17,25-26H,8,15-16,18-20H2,(H,33,35)(H4,30,31,32,34,36) |
| InChIKey | PCUPKXNTDNITLY-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 214.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.07 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|