C15H32Cl2N2O2 — CID 159883032
tert-butyl N-(4-chloro-2-methylbutan-2-yl)carbamate;4-chloro-2-methylbutan-2-amine (PubChem CID 159883032) has the molecular formula C15H32Cl2N2O2 and a molecular weight of 343.34 g/mol. Its IUPAC name is tert-butyl N-(4-chloro-2-methylbutan-2-yl)carbamate;4-chloro-2-methylbutan-2-amine.
| Compound Name | tert-butyl N-(4-chloro-2-methylbutan-2-yl)carbamate;4-chloro-2-methylbutan-2-amine |
|---|---|
| PubChem CID | 159883032 |
| Molecular Formula | C15H32Cl2N2O2 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | tert-butyl N-(4-chloro-2-methylbutan-2-yl)carbamate;4-chloro-2-methylbutan-2-amine |
| SMILES | CC(C)(CCCl)NC(=O)OC(C)(C)C.CC(C)(N)CCCl |
| InChI | InChI=1S/C10H20ClNO2.C5H12ClN/c1-9(2,3)14-8(13)12-10(4,5)6-7-11;1-5(2,7)3-4-6/h6-7H2,1-5H3,(H,12,13);3-4,7H2,1-2H3 |
| InChIKey | NTTSKDPYCNKMOT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|