C19H26O10 — CID 159883883
2-(2-prop-2-enoyloxyethoxy)ethyl prop-2-enoate;4,5,6-trihydroxynona-1,8-diene-3,7-dione (PubChem CID 159883883) has the molecular formula C19H26O10 and a molecular weight of 414.41 g/mol. Its IUPAC name is 2-(2-prop-2-enoyloxyethoxy)ethyl prop-2-enoate;4,5,6-trihydroxynona-1,8-diene-3,7-dione.
| Compound Name | 2-(2-prop-2-enoyloxyethoxy)ethyl prop-2-enoate;4,5,6-trihydroxynona-1,8-diene-3,7-dione |
|---|---|
| PubChem CID | 159883883 |
| Molecular Formula | C19H26O10 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 2-(2-prop-2-enoyloxyethoxy)ethyl prop-2-enoate;4,5,6-trihydroxynona-1,8-diene-3,7-dione |
| SMILES | C=CC(=O)C(O)C(O)C(O)C(=O)C=C.C=CC(=O)OCCOCCOC(=O)C=C |
| InChI | InChI=1S/C10H14O5.C9H12O5/c1-3-9(11)14-7-5-13-6-8-15-10(12)4-2;1-3-5(10)7(12)9(14)8(13)6(11)4-2/h3-4H,1-2,5-8H2;3-4,7-9,12-14H,1-2H2 |
| InChIKey | NTWPNRISZQSTHO-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|