C17H20O7 — CID 158214515
[4-hydroxy-6-(2-methylprop-2-enoyloxy)-3,7-dioxonona-1,8-dien-5-yl] 2-methylprop-2-enoate (PubChem CID 158214515) has the molecular formula C17H20O7 and a molecular weight of 336.34 g/mol. Its IUPAC name is [4-hydroxy-6-(2-methylprop-2-enoyloxy)-3,7-dioxonona-1,8-dien-5-yl] 2-methylprop-2-enoate.
| Compound Name | [4-hydroxy-6-(2-methylprop-2-enoyloxy)-3,7-dioxonona-1,8-dien-5-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158214515 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | [4-hydroxy-6-(2-methylprop-2-enoyloxy)-3,7-dioxonona-1,8-dien-5-yl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)C(O)C(OC(=O)C(=C)C)C(OC(=O)C(=C)C)C(=O)C=C |
| InChI | InChI=1S/C17H20O7/c1-7-11(18)13(20)15(24-17(22)10(5)6)14(12(19)8-2)23-16(21)9(3)4/h7-8,13-15,20H,1-3,5H2,4,6H3 |
| InChIKey | XFUXBJZOCXBCKE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|