C14H22O5 — CID 154362646
[2-hydroxy-5-methyl-3-(2-methylpropoxy)-4-oxohex-5-enyl] prop-2-enoate (PubChem CID 154362646) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is [2-hydroxy-5-methyl-3-(2-methylpropoxy)-4-oxohex-5-enyl] prop-2-enoate.
| Compound Name | [2-hydroxy-5-methyl-3-(2-methylpropoxy)-4-oxohex-5-enyl] prop-2-enoate |
|---|---|
| PubChem CID | 154362646 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | [2-hydroxy-5-methyl-3-(2-methylpropoxy)-4-oxohex-5-enyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)C(OCC(C)C)C(=O)C(=C)C |
| InChI | InChI=1S/C14H22O5/c1-6-12(16)18-8-11(15)14(13(17)10(4)5)19-7-9(2)3/h6,9,11,14-15H,1,4,7-8H2,2-3,5H3 |
| InChIKey | CODRJWWUZBVXSD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|