C13H16O8 — CID 139709315
(1,2,3-trihydroxy-5-methyl-4-oxo-3-prop-2-enoyloxyhex-5-en-2-yl) prop-2-enoate (PubChem CID 139709315) has the molecular formula C13H16O8 and a molecular weight of 300.26 g/mol. Its IUPAC name is (1,2,3-trihydroxy-5-methyl-4-oxo-3-prop-2-enoyloxyhex-5-en-2-yl) prop-2-enoate.
| Compound Name | (1,2,3-trihydroxy-5-methyl-4-oxo-3-prop-2-enoyloxyhex-5-en-2-yl) prop-2-enoate |
|---|---|
| PubChem CID | 139709315 |
| Molecular Formula | C13H16O8 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | (1,2,3-trihydroxy-5-methyl-4-oxo-3-prop-2-enoyloxyhex-5-en-2-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC(O)(CO)C(O)(OC(=O)C=C)C(=O)C(=C)C |
| InChI | InChI=1S/C13H16O8/c1-5-9(15)20-12(18,7-14)13(19,11(17)8(3)4)21-10(16)6-2/h5-6,14,18-19H,1-3,7H2,4H3 |
| InChIKey | AHRQIXNPHWEHRJ-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|