C10H14O6 — CID 139735101
(1,2,3-trihydroxy-4-oxohex-5-enyl) 2-methylprop-2-enoate (PubChem CID 139735101) has the molecular formula C10H14O6 and a molecular weight of 230.22 g/mol. Its IUPAC name is (1,2,3-trihydroxy-4-oxohex-5-enyl) 2-methylprop-2-enoate.
| Compound Name | (1,2,3-trihydroxy-4-oxohex-5-enyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139735101 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | (1,2,3-trihydroxy-4-oxohex-5-enyl) 2-methylprop-2-enoate |
| SMILES | C=CC(=O)C(O)C(O)C(O)OC(=O)C(=C)C |
| InChI | InChI=1S/C10H14O6/c1-4-6(11)7(12)8(13)10(15)16-9(14)5(2)3/h4,7-8,10,12-13,15H,1-2H2,3H3 |
| InChIKey | AWAAOWYGNDKQIC-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|