C18H24O8 — CID 157071415
ethane-1,2-diol;[5-(2-methylprop-2-enoyloxy)-3,6-dioxoocta-1,7-dien-4-yl] 2-methylprop-2-enoate (PubChem CID 157071415) has the molecular formula C18H24O8 and a molecular weight of 368.38 g/mol. Its IUPAC name is ethane-1,2-diol;[5-(2-methylprop-2-enoyloxy)-3,6-dioxoocta-1,7-dien-4-yl] 2-methylprop-2-enoate.
| Compound Name | ethane-1,2-diol;[5-(2-methylprop-2-enoyloxy)-3,6-dioxoocta-1,7-dien-4-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 157071415 |
| Molecular Formula | C18H24O8 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | ethane-1,2-diol;[5-(2-methylprop-2-enoyloxy)-3,6-dioxoocta-1,7-dien-4-yl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)C(OC(=O)C(=C)C)C(OC(=O)C(=C)C)C(=O)C=C.OCCO |
| InChI | InChI=1S/C16H18O6.C2H6O2/c1-7-11(17)13(21-15(19)9(3)4)14(12(18)8-2)22-16(20)10(5)6;3-1-2-4/h7-8,13-14H,1-3,5H2,4,6H3;3-4H,1-2H2 |
| InChIKey | ACMAXSUGSYVEMU-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|