C21H30O9 — CID 160980894
2-(2-hydroxypropoxy)propan-1-ol;(4-oxo-3-prop-2-enoyl-3-prop-2-enoyloxyhex-5-en-2-yl) prop-2-enoate (PubChem CID 160980894) has the molecular formula C21H30O9 and a molecular weight of 426.46 g/mol. Its IUPAC name is 2-(2-hydroxypropoxy)propan-1-ol;(4-oxo-3-prop-2-enoyl-3-prop-2-enoyloxyhex-5-en-2-yl) prop-2-enoate.
| Compound Name | 2-(2-hydroxypropoxy)propan-1-ol;(4-oxo-3-prop-2-enoyl-3-prop-2-enoyloxyhex-5-en-2-yl) prop-2-enoate |
|---|---|
| PubChem CID | 160980894 |
| Molecular Formula | C21H30O9 |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 2-(2-hydroxypropoxy)propan-1-ol;(4-oxo-3-prop-2-enoyl-3-prop-2-enoyloxyhex-5-en-2-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC(C)C(OC(=O)C=C)(C(=O)C=C)C(=O)C=C.CC(O)COC(C)CO |
| InChI | InChI=1S/C15H16O6.C6H14O3/c1-6-11(16)15(12(17)7-2,21-14(19)9-4)10(5)20-13(18)8-3;1-5(8)4-9-6(2)3-7/h6-10H,1-4H2,5H3;5-8H,3-4H2,1-2H3 |
| InChIKey | SZMPFWWGLVHJOG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|