C20H28O9 — CID 161125438
butane-1,4-diol;2-(3-oxo-2-prop-2-enoyl-2-prop-2-enoyloxypent-4-enoxy)ethyl prop-2-enoate (PubChem CID 161125438) has the molecular formula C20H28O9 and a molecular weight of 412.44 g/mol. Its IUPAC name is butane-1,4-diol;2-(3-oxo-2-prop-2-enoyl-2-prop-2-enoyloxypent-4-enoxy)ethyl prop-2-enoate.
| Compound Name | butane-1,4-diol;2-(3-oxo-2-prop-2-enoyl-2-prop-2-enoyloxypent-4-enoxy)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 161125438 |
| Molecular Formula | C20H28O9 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | butane-1,4-diol;2-(3-oxo-2-prop-2-enoyl-2-prop-2-enoyloxypent-4-enoxy)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCC(OC(=O)C=C)(C(=O)C=C)C(=O)C=C.OCCCCO |
| InChI | InChI=1S/C16H18O7.C4H10O2/c1-5-12(17)16(13(18)6-2,23-15(20)8-4)11-21-9-10-22-14(19)7-3;5-3-1-2-4-6/h5-8H,1-4,9-11H2;5-6H,1-4H2 |
| InChIKey | ULMQFFLBUQAKHW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|