C22H30O9 — CID 159875861
2-[2-[2-[2-(2-methylprop-2-enoyloxy)-3-oxo-2-prop-2-enoylpent-4-enoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 159875861) has the molecular formula C22H30O9 and a molecular weight of 438.47 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-methylprop-2-enoyloxy)-3-oxo-2-prop-2-enoylpent-4-enoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2-[2-(2-methylprop-2-enoyloxy)-3-oxo-2-prop-2-enoylpent-4-enoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159875861 |
| Molecular Formula | C22H30O9 |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 2-[2-[2-[2-(2-methylprop-2-enoyloxy)-3-oxo-2-prop-2-enoylpent-4-enoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)C(COCCOCCOCCOC(=O)C(=C)C)(OC(=O)C(=C)C)C(=O)C=C |
| InChI | InChI=1S/C22H30O9/c1-7-18(23)22(19(24)8-2,31-21(26)17(5)6)15-29-12-11-27-9-10-28-13-14-30-20(25)16(3)4/h7-8H,1-3,5,9-15H2,4,6H3 |
| InChIKey | HKGVKUBCRGORCI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|