About [2-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-3-methylpentan-3-yl] 2-methylprop-2-enoate
[2-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-3-methylpentan-3-yl] 2-methylprop-2-enoate (PubChem CID 130470167) has the molecular formula C18H30O4
and a molecular weight of 310.43 g/mol. Its IUPAC name is [2-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-3-methylpentan-3-yl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [2-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-3-methylpentan-3-yl] 2-methylprop-2-enoate |
| PubChem CID | 130470167 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | [2-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-3-methylpentan-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(CC)C(C)OC(C)(CC)C(=O)C(=C)C |
| InChI | InChI=1S/C18H30O4/c1-10-17(8,22-16(20)13(5)6)14(7)21-18(9,11-2)15(19)12(3)4/h14H,3,5,10-11H2,1-2,4,6-9H3 |
| InChIKey | LJFJNDCFJXXOPG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-3-methylpentan-3-yl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-3-methylpentan-3-yl] 2-methylprop-2-enoate?
The IUPAC name of [2-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-3-methylpentan-3-yl] 2-methylprop-2-enoate (CID 130470167) is [2-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-3-methylpentan-3-yl] 2-methylprop-2-enoate.
What is the SMILES notation for [2-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-3-methylpentan-3-yl] 2-methylprop-2-enoate?
The canonical SMILES for [2-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-3-methylpentan-3-yl] 2-methylprop-2-enoate is C=C(C)C(=O)OC(C)(CC)C(C)OC(C)(CC)C(=O)C(=C)C.
What is the InChIKey of [2-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-3-methylpentan-3-yl] 2-methylprop-2-enoate?
The InChIKey is LJFJNDCFJXXOPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O4/c1-10-17(8,22-16(20)13(5)6)14(7)21-18(9,11-2)15(19)12(3)4/h14H,3,5,10-11H2,1-2,4,6-9H3.
What are the key properties of [2-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-3-methylpentan-3-yl] 2-methylprop-2-enoate?
[2-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-3-methylpentan-3-yl] 2-methylprop-2-enoate has a molecular weight of 310.43 g/mol, XLogP of 3.99, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-3-methylpentan-3-yl] 2-methylprop-2-enoate is sourced from PubChem (CID 130470167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).