C16H26O4 — CID 88872119
[4-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxy-2-methylbutan-2-yl] 2-methylprop-2-enoate (PubChem CID 88872119) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is [4-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxy-2-methylbutan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [4-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxy-2-methylbutan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88872119 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | [4-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxy-2-methylbutan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)CCOC(C)(C)C(=O)C(=C)C |
| InChI | InChI=1S/C16H26O4/c1-11(2)13(17)16(7,8)19-10-9-15(5,6)20-14(18)12(3)4/h1,3,9-10H2,2,4-8H3 |
| InChIKey | ANYPMRDCIJPBRF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|