About [4-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxy-2-methylbutan-2-yl] 2-methylprop-2-enoate
[4-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxy-2-methylbutan-2-yl] 2-methylprop-2-enoate (PubChem CID 88872119) has the molecular formula C16H26O4
and a molecular weight of 282.38 g/mol. Its IUPAC name is [4-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxy-2-methylbutan-2-yl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [4-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxy-2-methylbutan-2-yl] 2-methylprop-2-enoate |
| PubChem CID | 88872119 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | [4-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxy-2-methylbutan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)CCOC(C)(C)C(=O)C(=C)C |
| InChI | InChI=1S/C16H26O4/c1-11(2)13(17)16(7,8)19-10-9-15(5,6)20-14(18)12(3)4/h1,3,9-10H2,2,4-8H3 |
| InChIKey | ANYPMRDCIJPBRF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxy-2-methylbutan-2-yl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxy-2-methylbutan-2-yl] 2-methylprop-2-enoate?
The IUPAC name of [4-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxy-2-methylbutan-2-yl] 2-methylprop-2-enoate (CID 88872119) is [4-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxy-2-methylbutan-2-yl] 2-methylprop-2-enoate.
What is the SMILES notation for [4-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxy-2-methylbutan-2-yl] 2-methylprop-2-enoate?
The canonical SMILES for [4-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxy-2-methylbutan-2-yl] 2-methylprop-2-enoate is C=C(C)C(=O)OC(C)(C)CCOC(C)(C)C(=O)C(=C)C.
What is the InChIKey of [4-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxy-2-methylbutan-2-yl] 2-methylprop-2-enoate?
The InChIKey is ANYPMRDCIJPBRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O4/c1-11(2)13(17)16(7,8)19-10-9-15(5,6)20-14(18)12(3)4/h1,3,9-10H2,2,4-8H3.
What are the key properties of [4-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxy-2-methylbutan-2-yl] 2-methylprop-2-enoate?
[4-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxy-2-methylbutan-2-yl] 2-methylprop-2-enoate has a molecular weight of 282.38 g/mol, XLogP of 3.21, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,4-dimethyl-3-oxopent-4-en-2-yl)oxy-2-methylbutan-2-yl] 2-methylprop-2-enoate is sourced from PubChem (CID 88872119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).