C30H48O14 — CID 159875860
2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;2-[2-[2-[2-(2-methylprop-2-enoyloxy)-3-oxo-2-prop-2-enoylpent-4-enoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 159875860) has the molecular formula C30H48O14 and a molecular weight of 632.70 g/mol. Its IUPAC name is 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;2-[2-[2-[2-(2-methylprop-2-enoyloxy)-3-oxo-2-prop-2-enoylpent-4-enoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;2-[2-[2-[2-(2-methylprop-2-enoyloxy)-3-oxo-2-prop-2-enoylpent-4-enoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159875860 |
| Molecular Formula | C30H48O14 |
| Molecular Weight | 632.70 g/mol |
| Exact Mass | 632.30 |
| IUPAC Name | 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;2-[2-[2-[2-(2-methylprop-2-enoyloxy)-3-oxo-2-prop-2-enoylpent-4-enoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)C(COCCOCCOCCOC(=O)C(=C)C)(OC(=O)C(=C)C)C(=O)C=C.OCCOCCOCCOCCO |
| InChI | InChI=1S/C22H30O9.C8H18O5/c1-7-18(23)22(19(24)8-2,31-21(26)17(5)6)15-29-12-11-27-9-10-28-13-14-30-20(25)16(3)4;9-1-3-11-5-7-13-8-6-12-4-2-10/h7-8H,1-3,5,9-15H2,4,6H3;9-10H,1-8H2 |
| InChIKey | NSWYOPAFMZTCDO-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 182.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.70 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|