C18H24O9 — CID 161280630
ethane-1,2-diol;2-(3-oxo-2-prop-2-enoyl-2-prop-2-enoyloxypent-4-enoxy)ethyl prop-2-enoate (PubChem CID 161280630) has the molecular formula C18H24O9 and a molecular weight of 384.38 g/mol. Its IUPAC name is ethane-1,2-diol;2-(3-oxo-2-prop-2-enoyl-2-prop-2-enoyloxypent-4-enoxy)ethyl prop-2-enoate.
| Compound Name | ethane-1,2-diol;2-(3-oxo-2-prop-2-enoyl-2-prop-2-enoyloxypent-4-enoxy)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 161280630 |
| Molecular Formula | C18H24O9 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | ethane-1,2-diol;2-(3-oxo-2-prop-2-enoyl-2-prop-2-enoyloxypent-4-enoxy)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCC(OC(=O)C=C)(C(=O)C=C)C(=O)C=C.OCCO |
| InChI | InChI=1S/C16H18O7.C2H6O2/c1-5-12(17)16(13(18)6-2,23-15(20)8-4)11-21-9-10-22-14(19)7-3;3-1-2-4/h5-8H,1-4,9-11H2;3-4H,1-2H2 |
| InChIKey | VFAMXHWLWZSHAR-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|