C16H20O8 — CID 174843171
bis(2-hydroxy-4-methyl-3-oxopent-4-enyl) (Z)-but-2-enedioate (PubChem CID 174843171) has the molecular formula C16H20O8 and a molecular weight of 340.33 g/mol. Its IUPAC name is bis(2-hydroxy-4-methyl-3-oxopent-4-enyl) (Z)-but-2-enedioate.
| Compound Name | bis(2-hydroxy-4-methyl-3-oxopent-4-enyl) (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 174843171 |
| Molecular Formula | C16H20O8 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | bis(2-hydroxy-4-methyl-3-oxopent-4-enyl) (Z)-but-2-enedioate |
| SMILES | C=C(C)C(=O)C(O)COC(=O)/C=C\C(=O)OCC(O)C(=O)C(=C)C |
| InChI | InChI=1S/C16H20O8/c1-9(2)15(21)11(17)7-23-13(19)5-6-14(20)24-8-12(18)16(22)10(3)4/h5-6,11-12,17-18H,1,3,7-8H2,2,4H3/b6-5- |
| InChIKey | BRVDMVUDYBVKIL-WAYWQWQTSA-N |
| XLogP | -0.36 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|