C22H28O9 — CID 143015464
methyl 2-[(2Z)-2-[(3Z,5E,8S,9S,11Z,14S)-8,9-dihydroxy-3-(1-hydroxyprop-2-enylidene)-14-methyl-2,10-dioxo-1-oxacyclotetradeca-5,11-dien-4-ylidene]ethoxy]acetate (PubChem CID 143015464) has the molecular formula C22H28O9 and a molecular weight of 436.46 g/mol. Its IUPAC name is methyl 2-[(2Z)-2-[(3Z,5E,8S,9S,11Z,14S)-8,9-dihydroxy-3-(1-hydroxyprop-2-enylidene)-14-methyl-2,10-dioxo-1-oxacyclotetradeca-5,11-dien-4-ylidene]ethoxy]acetate.
| Compound Name | methyl 2-[(2Z)-2-[(3Z,5E,8S,9S,11Z,14S)-8,9-dihydroxy-3-(1-hydroxyprop-2-enylidene)-14-methyl-2,10-dioxo-1-oxacyclotetradeca-5,11-dien-4-ylidene]ethoxy]acetate |
|---|---|
| PubChem CID | 143015464 |
| Molecular Formula | C22H28O9 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | methyl 2-[(2Z)-2-[(3Z,5E,8S,9S,11Z,14S)-8,9-dihydroxy-3-(1-hydroxyprop-2-enylidene)-14-methyl-2,10-dioxo-1-oxacyclotetradeca-5,11-dien-4-ylidene]ethoxy]acetate |
| SMILES | C=C/C(O)=C1/C(=O)O[C@@H](C)C/C=C\C(=O)[C@@H](O)[C@@H](O)C/C=C/C1=C/COCC(=O)OC |
| InChI | InChI=1S/C22H28O9/c1-4-16(23)20-15(11-12-30-13-19(26)29-3)8-6-10-18(25)21(27)17(24)9-5-7-14(2)31-22(20)28/h4-6,8-9,11,14,18,21,23,25,27H,1,7,10,12-13H2,2-3H3/b8-6+,9-5-,15-11-,20-16-/t14-,18-,21+/m0/s1 |
| InChIKey | KOBNETFQURFVLZ-OLQBKVEBSA-N |
| XLogP | 1.23 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|