C15H18O5 — CID 135038958
(3Z,5R)-3-[(2E,4E,6E)-1-hydroxy-4,6-dimethylocta-2,4,6-trienylidene]-5-(hydroxymethyl)oxolane-2,4-dione (PubChem CID 135038958) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (3Z,5R)-3-[(2E,4E,6E)-1-hydroxy-4,6-dimethylocta-2,4,6-trienylidene]-5-(hydroxymethyl)oxolane-2,4-dione.
| Compound Name | (3Z,5R)-3-[(2E,4E,6E)-1-hydroxy-4,6-dimethylocta-2,4,6-trienylidene]-5-(hydroxymethyl)oxolane-2,4-dione |
|---|---|
| PubChem CID | 135038958 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (3Z,5R)-3-[(2E,4E,6E)-1-hydroxy-4,6-dimethylocta-2,4,6-trienylidene]-5-(hydroxymethyl)oxolane-2,4-dione |
| SMILES | C/C=C(C)/C=C(C)/C=C/C(O)=C1/C(=O)O[C@H](CO)C1=O |
| InChI | InChI=1S/C15H18O5/c1-4-9(2)7-10(3)5-6-11(17)13-14(18)12(8-16)20-15(13)19/h4-7,12,16-17H,8H2,1-3H3/b6-5+,9-4+,10-7+,13-11-/t12-/m1/s1 |
| InChIKey | OMAXLFPXHHLNMZ-KJCHAWPRSA-N |
| XLogP | 1.75 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|