C18H22O5 — CID 135011429
(3Z,5R)-5-(hydroxymethyl)-3-[(2E,4E,6E,8E)-1-hydroxy-2,6,8-trimethyldeca-2,4,6,8-tetraenylidene]oxolane-2,4-dione (PubChem CID 135011429) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is (3Z,5R)-5-(hydroxymethyl)-3-[(2E,4E,6E,8E)-1-hydroxy-2,6,8-trimethyldeca-2,4,6,8-tetraenylidene]oxolane-2,4-dione.
| Compound Name | (3Z,5R)-5-(hydroxymethyl)-3-[(2E,4E,6E,8E)-1-hydroxy-2,6,8-trimethyldeca-2,4,6,8-tetraenylidene]oxolane-2,4-dione |
|---|---|
| PubChem CID | 135011429 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | (3Z,5R)-5-(hydroxymethyl)-3-[(2E,4E,6E,8E)-1-hydroxy-2,6,8-trimethyldeca-2,4,6,8-tetraenylidene]oxolane-2,4-dione |
| SMILES | C/C=C(C)/C=C(C)/C=C/C=C(C)/C(O)=C1/C(=O)O[C@H](CO)C1=O |
| InChI | InChI=1S/C18H22O5/c1-5-11(2)9-12(3)7-6-8-13(4)16(20)15-17(21)14(10-19)23-18(15)22/h5-9,14,19-20H,10H2,1-4H3/b7-6+,11-5+,12-9+,13-8+,16-15-/t14-/m1/s1 |
| InChIKey | HUVZUHZQSDRIBH-QXMBQXOCSA-N |
| XLogP | 2.70 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|