C19H22F2O7 — CID 122194136
(4S,6Z,9S,10S,12E)-15,15-difluoro-9,10,18-trihydroxy-16-methoxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,16-tetraene-2,8-dione (PubChem CID 122194136) has the molecular formula C19H22F2O7 and a molecular weight of 400.37 g/mol. Its IUPAC name is (4S,6Z,9S,10S,12E)-15,15-difluoro-9,10,18-trihydroxy-16-methoxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,16-tetraene-2,8-dione.
| Compound Name | (4S,6Z,9S,10S,12E)-15,15-difluoro-9,10,18-trihydroxy-16-methoxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,16-tetraene-2,8-dione |
|---|---|
| PubChem CID | 122194136 |
| Molecular Formula | C19H22F2O7 |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (4S,6Z,9S,10S,12E)-15,15-difluoro-9,10,18-trihydroxy-16-methoxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,16-tetraene-2,8-dione |
| SMILES | COC1=CC(O)C2=C(/C=C/C[C@H](O)[C@H](O)C(=O)/C=C\C[C@H](C)OC2=O)C1(F)F |
| InChI | InChI=1S/C19H22F2O7/c1-10-5-3-7-12(22)17(25)13(23)8-4-6-11-16(18(26)28-10)14(24)9-15(27-2)19(11,20)21/h3-4,6-7,9-10,13-14,17,23-25H,5,8H2,1-2H3/b6-4+,7-3-/t10-,13-,14?,17+/m0/s1 |
| InChIKey | MGYLTQDOBWOTOH-RDCIWMMBSA-N |
| XLogP | 0.95 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |