C12H11ClN6OS2 — CID 159884150
4-chloro-2-methylsulfanylpyrimidine-5-carbaldehyde;6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidine (PubChem CID 159884150) has the molecular formula C12H11ClN6OS2 and a molecular weight of 354.85 g/mol. Its IUPAC name is 4-chloro-2-methylsulfanylpyrimidine-5-carbaldehyde;6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidine.
| Compound Name | 4-chloro-2-methylsulfanylpyrimidine-5-carbaldehyde;6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 159884150 |
| Molecular Formula | C12H11ClN6OS2 |
| Molecular Weight | 354.85 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 4-chloro-2-methylsulfanylpyrimidine-5-carbaldehyde;6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidine |
| SMILES | CSc1ncc(C=O)c(Cl)n1.CSc1ncc2cn[nH]c2n1 |
| InChI | InChI=1S/C6H5ClN2OS.C6H6N4S/c1-11-6-8-2-4(3-10)5(7)9-6;1-11-6-7-2-4-3-8-10-5(4)9-6/h2-3H,1H3;2-3H,1H3,(H,7,8,9,10) |
| InChIKey | NTXLAJRHFHEDIY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.85 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|