C17H16F2O6S — CID 159885282
4-fluoro-2-methoxybenzoic acid;4-fluoro-2-methoxy-6-methylsulfanylbenzoic acid (PubChem CID 159885282) has the molecular formula C17H16F2O6S and a molecular weight of 386.37 g/mol. Its IUPAC name is 4-fluoro-2-methoxybenzoic acid;4-fluoro-2-methoxy-6-methylsulfanylbenzoic acid.
| Compound Name | 4-fluoro-2-methoxybenzoic acid;4-fluoro-2-methoxy-6-methylsulfanylbenzoic acid |
|---|---|
| PubChem CID | 159885282 |
| Molecular Formula | C17H16F2O6S |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 4-fluoro-2-methoxybenzoic acid;4-fluoro-2-methoxy-6-methylsulfanylbenzoic acid |
| SMILES | COc1cc(F)cc(SC)c1C(=O)O.COc1cc(F)ccc1C(=O)O |
| InChI | InChI=1S/C9H9FO3S.C8H7FO3/c1-13-6-3-5(10)4-7(14-2)8(6)9(11)12;1-12-7-4-5(9)2-3-6(7)8(10)11/h3-4H,1-2H3,(H,11,12);2-4H,1H3,(H,10,11) |
| InChIKey | NUBCCEVPTFSFKJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |