About carbanide;2-fluoroethyl-methanidyl-dimethylazanium;tungsten
carbanide;2-fluoroethyl-methanidyl-dimethylazanium;tungsten (PubChem CID 159886372) has the molecular formula C6H15FNW-
and a molecular weight of 304.03 g/mol. Its IUPAC name is carbanide;2-fluoroethyl-methanidyl-dimethylazanium;tungsten.
Molecular Properties
| Compound Name | carbanide;2-fluoroethyl-methanidyl-dimethylazanium;tungsten |
| PubChem CID | 159886372 |
| Molecular Formula | C6H15FNW- |
| Molecular Weight | 304.03 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | carbanide;2-fluoroethyl-methanidyl-dimethylazanium;tungsten |
| SMILES | [CH2-][N+](C)(C)CCF.[CH3-].[W] |
| InChI | InChI=1S/C5H12FN.CH3.W/c1-7(2,3)5-4-6;;/h1,4-5H2,2-3H3;1H3;/q;-1; |
| InChIKey | NUEOOTXKVZTQFK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.03 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze carbanide;2-fluoroethyl-methanidyl-dimethylazanium;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;2-fluoroethyl-methanidyl-dimethylazanium;tungsten?
The IUPAC name of carbanide;2-fluoroethyl-methanidyl-dimethylazanium;tungsten (CID 159886372) is carbanide;2-fluoroethyl-methanidyl-dimethylazanium;tungsten.
What is the SMILES notation for carbanide;2-fluoroethyl-methanidyl-dimethylazanium;tungsten?
The canonical SMILES for carbanide;2-fluoroethyl-methanidyl-dimethylazanium;tungsten is [CH2-][N+](C)(C)CCF.[CH3-].[W].
What is the InChIKey of carbanide;2-fluoroethyl-methanidyl-dimethylazanium;tungsten?
The InChIKey is NUEOOTXKVZTQFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12FN.CH3.W/c1-7(2,3)5-4-6;;/h1,4-5H2,2-3H3;1H3;/q;-1;.
What are the key properties of carbanide;2-fluoroethyl-methanidyl-dimethylazanium;tungsten?
carbanide;2-fluoroethyl-methanidyl-dimethylazanium;tungsten has a molecular weight of 304.03 g/mol, XLogP of 1.27, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;2-fluoroethyl-methanidyl-dimethylazanium;tungsten is sourced from PubChem (CID 159886372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).