C16H35N2+ — CID 167390064
methanidyl-dimethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium (PubChem CID 167390064) has the molecular formula C16H35N2+ and a molecular weight of 255.47 g/mol. Its IUPAC name is methanidyl-dimethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium.
| Compound Name | methanidyl-dimethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium |
|---|---|
| PubChem CID | 167390064 |
| Molecular Formula | C16H35N2+ |
| Molecular Weight | 255.47 g/mol |
| Exact Mass | 255.28 |
| IUPAC Name | methanidyl-dimethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium |
| SMILES | [CH2-][N+](C)(C)CCCCCC[N+]1(C)CC(C)C(C)C1 |
| InChI | InChI=1S/C16H35N2/c1-15-13-18(6,14-16(15)2)12-10-8-7-9-11-17(3,4)5/h15-16H,3,7-14H2,1-2,4-6H3/q+1 |
| InChIKey | TXZVEGZINGNFMK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|