About diethyl-ethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium
diethyl-ethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium (PubChem CID 167390065) has the molecular formula C19H41N2+
and a molecular weight of 297.55 g/mol. Its IUPAC name is diethyl-ethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium.
Molecular Properties
| Compound Name | diethyl-ethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium |
| PubChem CID | 167390065 |
| Molecular Formula | C19H41N2+ |
| Molecular Weight | 297.55 g/mol |
| Exact Mass | 297.33 |
| IUPAC Name | diethyl-ethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium |
| SMILES | C[CH-][N+](CC)(CC)CCCCCC[N+]1(C)CC(C)C(C)C1 |
| InChI | InChI=1S/C19H41N2/c1-7-21(8-2,9-3)15-13-11-10-12-14-20(6)16-18(4)19(5)17-20/h7,18-19H,8-17H2,1-6H3/q+1 |
| InChIKey | MIAGCUMEFOQGPB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze diethyl-ethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl-ethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium?
The IUPAC name of diethyl-ethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium (CID 167390065) is diethyl-ethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium.
What is the SMILES notation for diethyl-ethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium?
The canonical SMILES for diethyl-ethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium is C[CH-][N+](CC)(CC)CCCCCC[N+]1(C)CC(C)C(C)C1.
What is the InChIKey of diethyl-ethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium?
The InChIKey is MIAGCUMEFOQGPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H41N2/c1-7-21(8-2,9-3)15-13-11-10-12-14-20(6)16-18(4)19(5)17-20/h7,18-19H,8-17H2,1-6H3/q+1.
What are the key properties of diethyl-ethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium?
diethyl-ethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium has a molecular weight of 297.55 g/mol, XLogP of 4.32, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl-ethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium is sourced from PubChem (CID 167390065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).