C19H41N2+ — CID 167390065
diethyl-ethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium (PubChem CID 167390065) has the molecular formula C19H41N2+ and a molecular weight of 297.55 g/mol. Its IUPAC name is diethyl-ethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium.
| Compound Name | diethyl-ethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium |
|---|---|
| PubChem CID | 167390065 |
| Molecular Formula | C19H41N2+ |
| Molecular Weight | 297.55 g/mol |
| Exact Mass | 297.33 |
| IUPAC Name | diethyl-ethyl-[6-(1,3,4-trimethylpyrrolidin-1-ium-1-yl)hexyl]azanium |
| SMILES | C[CH-][N+](CC)(CC)CCCCCC[N+]1(C)CC(C)C(C)C1 |
| InChI | InChI=1S/C19H41N2/c1-7-21(8-2,9-3)15-13-11-10-12-14-20(6)16-18(4)19(5)17-20/h7,18-19H,8-17H2,1-6H3/q+1 |
| InChIKey | MIAGCUMEFOQGPB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|