C23H36 — CID 159886761
1-tert-butylcyclohexene;1-tert-butyl-2,3-dihydro-1H-indene (PubChem CID 159886761) has the molecular formula C23H36 and a molecular weight of 312.54 g/mol. Its IUPAC name is 1-tert-butylcyclohexene;1-tert-butyl-2,3-dihydro-1H-indene.
| Compound Name | 1-tert-butylcyclohexene;1-tert-butyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 159886761 |
| Molecular Formula | C23H36 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | 1-tert-butylcyclohexene;1-tert-butyl-2,3-dihydro-1H-indene |
| SMILES | CC(C)(C)C1=CCCCC1.CC(C)(C)C1CCc2ccccc21 |
| InChI | InChI=1S/C13H18.C10H18/c1-13(2,3)12-9-8-10-6-4-5-7-11(10)12;1-10(2,3)9-7-5-4-6-8-9/h4-7,12H,8-9H2,1-3H3;7H,4-6,8H2,1-3H3 |
| InChIKey | NUFRAMRAUFFDNB-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|