About 3-tert-butyl-4,5-dihydro-3H-1-benzazepin-1-id-2-one;rubidium(1+)
3-tert-butyl-4,5-dihydro-3H-1-benzazepin-1-id-2-one;rubidium(1+) (PubChem CID 58765126) has the molecular formula C14H18NORb
and a molecular weight of 301.77 g/mol. Its IUPAC name is 3-tert-butyl-4,5-dihydro-3H-1-benzazepin-1-id-2-one;rubidium(1+).
Molecular Properties
| Compound Name | 3-tert-butyl-4,5-dihydro-3H-1-benzazepin-1-id-2-one;rubidium(1+) |
| PubChem CID | 58765126 |
| Molecular Formula | C14H18NORb |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 3-tert-butyl-4,5-dihydro-3H-1-benzazepin-1-id-2-one;rubidium(1+) |
| SMILES | CC(C)(C)C1CCc2ccccc2[N-]C1=O.[Rb+] |
| InChI | InChI=1S/C14H19NO.Rb/c1-14(2,3)11-9-8-10-6-4-5-7-12(10)15-13(11)16;/h4-7,11H,8-9H2,1-3H3,(H,15,16);/q;+1/p-1 |
| InChIKey | AFYFIZCOXHHAEQ-UHFFFAOYSA-M |
| XLogP | 0.83 |
| TPSA | 31.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-tert-butyl-4,5-dihydro-3H-1-benzazepin-1-id-2-one;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-4,5-dihydro-3H-1-benzazepin-1-id-2-one;rubidium(1+)?
The IUPAC name of 3-tert-butyl-4,5-dihydro-3H-1-benzazepin-1-id-2-one;rubidium(1+) (CID 58765126) is 3-tert-butyl-4,5-dihydro-3H-1-benzazepin-1-id-2-one;rubidium(1+).
What is the SMILES notation for 3-tert-butyl-4,5-dihydro-3H-1-benzazepin-1-id-2-one;rubidium(1+)?
The canonical SMILES for 3-tert-butyl-4,5-dihydro-3H-1-benzazepin-1-id-2-one;rubidium(1+) is CC(C)(C)C1CCc2ccccc2[N-]C1=O.[Rb+].
What is the InChIKey of 3-tert-butyl-4,5-dihydro-3H-1-benzazepin-1-id-2-one;rubidium(1+)?
The InChIKey is AFYFIZCOXHHAEQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H19NO.Rb/c1-14(2,3)11-9-8-10-6-4-5-7-12(10)15-13(11)16;/h4-7,11H,8-9H2,1-3H3,(H,15,16);/q;+1/p-1.
What are the key properties of 3-tert-butyl-4,5-dihydro-3H-1-benzazepin-1-id-2-one;rubidium(1+)?
3-tert-butyl-4,5-dihydro-3H-1-benzazepin-1-id-2-one;rubidium(1+) has a molecular weight of 301.77 g/mol, XLogP of 0.83, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-4,5-dihydro-3H-1-benzazepin-1-id-2-one;rubidium(1+) is sourced from PubChem (CID 58765126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).