C11H16NRb — CID 145270210
3,4-dihydro-2H-quinolin-1-ide;ethane;rubidium(1+) (PubChem CID 145270210) has the molecular formula C11H16NRb and a molecular weight of 247.72 g/mol. Its IUPAC name is 3,4-dihydro-2H-quinolin-1-ide;ethane;rubidium(1+).
| Compound Name | 3,4-dihydro-2H-quinolin-1-ide;ethane;rubidium(1+) |
|---|---|
| PubChem CID | 145270210 |
| Molecular Formula | C11H16NRb |
| Molecular Weight | 247.72 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 3,4-dihydro-2H-quinolin-1-ide;ethane;rubidium(1+) |
| SMILES | CC.[Rb+].c1ccc2c(c1)CCC[N-]2 |
| InChI | InChI=1S/C9H10N.C2H6.Rb/c1-2-6-9-8(4-1)5-3-7-10-9;1-2;/h1-2,4,6H,3,5,7H2;1-2H3;/q-1;;+1 |
| InChIKey | FNNABHUGPQHWAQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.72 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |