C8H8KN — CID 162731101
potassium 2,3-dihydroindol-1-ide (PubChem CID 162731101) has the molecular formula C8H8KN and a molecular weight of 157.26 g/mol. Its IUPAC name is potassium 2,3-dihydroindol-1-ide.
| Compound Name | potassium 2,3-dihydroindol-1-ide |
|---|---|
| PubChem CID | 162731101 |
| Molecular Formula | C8H8KN |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | potassium 2,3-dihydroindol-1-ide |
| SMILES | [K+].c1ccc2c(c1)CC[N-]2 |
| InChI | InChI=1S/C8H8N.K/c1-2-4-8-7(3-1)5-6-9-8;/h1-4H,5-6H2;/q-1;+1 |
| InChIKey | JJZJDLFAMVQTKT-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |