potassium 2,3-dihydroindol-1-ide

C8H8KN — CID 162731101

IUPACpotassium 2,3-dihydroindol-1-ide
SMILES[K+].c1ccc2c(c1)CC[N-]2
InChIInChI=1S/C8H8N.K/c1-2-4-8-7(3-1)5-6-9-8;/h1-4H,5-6H2;/q-1;+1
InChIKeyJJZJDLFAMVQTKT-UHFFFAOYSA-N
MW157.26 g/mol
LogP-0.75
Rot. Bonds

About potassium 2,3-dihydroindol-1-ide

potassium 2,3-dihydroindol-1-ide (PubChem CID 162731101) has the molecular formula C8H8KN and a molecular weight of 157.26 g/mol. Its IUPAC name is potassium 2,3-dihydroindol-1-ide.

Molecular Properties

Compound Namepotassium 2,3-dihydroindol-1-ide
PubChem CID162731101
Molecular FormulaC8H8KN
Molecular Weight157.26 g/mol
Exact Mass157.03
IUPAC Namepotassium 2,3-dihydroindol-1-ide
SMILES[K+].c1ccc2c(c1)CC[N-]2
InChIInChI=1S/C8H8N.K/c1-2-4-8-7(3-1)5-6-9-8;/h1-4H,5-6H2;/q-1;+1
InChIKeyJJZJDLFAMVQTKT-UHFFFAOYSA-N
XLogP-0.75
TPSA14.10 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.26
LogP ≤ 5-0.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Analyze potassium 2,3-dihydroindol-1-ide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 2,3-dihydroindol-1-ide?
The IUPAC name of potassium 2,3-dihydroindol-1-ide (CID 162731101) is potassium 2,3-dihydroindol-1-ide.
What is the SMILES notation for potassium 2,3-dihydroindol-1-ide?
The canonical SMILES for potassium 2,3-dihydroindol-1-ide is [K+].c1ccc2c(c1)CC[N-]2.
What is the InChIKey of potassium 2,3-dihydroindol-1-ide?
The InChIKey is JJZJDLFAMVQTKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N.K/c1-2-4-8-7(3-1)5-6-9-8;/h1-4H,5-6H2;/q-1;+1.
What are the key properties of potassium 2,3-dihydroindol-1-ide?
potassium 2,3-dihydroindol-1-ide has a molecular weight of 157.26 g/mol, XLogP of -0.75, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2,3-dihydroindol-1-ide is sourced from PubChem (CID 162731101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).