C20H33NTi — CID 58351221
carbanide;7-(2,3,4,5-tetramethylcyclopentyl)-2,3-dihydroindol-1-ide;titanium(4+) (PubChem CID 58351221) has the molecular formula C20H33NTi and a molecular weight of 335.36 g/mol. Its IUPAC name is carbanide;7-(2,3,4,5-tetramethylcyclopentyl)-2,3-dihydroindol-1-ide;titanium(4+).
| Compound Name | carbanide;7-(2,3,4,5-tetramethylcyclopentyl)-2,3-dihydroindol-1-ide;titanium(4+) |
|---|---|
| PubChem CID | 58351221 |
| Molecular Formula | C20H33NTi |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | carbanide;7-(2,3,4,5-tetramethylcyclopentyl)-2,3-dihydroindol-1-ide;titanium(4+) |
| SMILES | CC1C(C)C(C)C(c2cccc3c2[N-]CC3)C1C.[CH3-].[CH3-].[CH3-].[Ti+4] |
| InChI | InChI=1S/C17H24N.3CH3.Ti/c1-10-11(2)13(4)16(12(10)3)15-7-5-6-14-8-9-18-17(14)15;;;;/h5-7,10-13,16H,8-9H2,1-4H3;3*1H3;/q4*-1;+4 |
| InChIKey | SEDNJHRPUXCHBH-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|