C18H27NO — CID 23555190
1,3-ditert-butyl-4,5-dihydro-3H-1-benzazepin-2-one (PubChem CID 23555190) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 1,3-ditert-butyl-4,5-dihydro-3H-1-benzazepin-2-one.
| Compound Name | 1,3-ditert-butyl-4,5-dihydro-3H-1-benzazepin-2-one |
|---|---|
| PubChem CID | 23555190 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 1,3-ditert-butyl-4,5-dihydro-3H-1-benzazepin-2-one |
| SMILES | CC(C)(C)C1CCc2ccccc2N(C(C)(C)C)C1=O |
| InChI | InChI=1S/C18H27NO/c1-17(2,3)14-12-11-13-9-7-8-10-15(13)19(16(14)20)18(4,5)6/h7-10,14H,11-12H2,1-6H3 |
| InChIKey | LLPFZIGVEPLBPM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |