C33H60O6S — CID 159887277
[(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] tridecanoate;molecular hydrogen;S-tetradeca-1,3,5,7,9,11,13-heptaynyl ethanethioate (PubChem CID 159887277) has the molecular formula C33H60O6S and a molecular weight of 584.90 g/mol. Its IUPAC name is [(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] tridecanoate;molecular hydrogen;S-tetradeca-1,3,5,7,9,11,13-heptaynyl ethanethioate.
| Compound Name | [(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] tridecanoate;molecular hydrogen;S-tetradeca-1,3,5,7,9,11,13-heptaynyl ethanethioate |
|---|---|
| PubChem CID | 159887277 |
| Molecular Formula | C33H60O6S |
| Molecular Weight | 584.90 g/mol |
| Exact Mass | 584.41 |
| IUPAC Name | [(2R)-1-hydroxy-3-(hydroxymethoxy)propan-2-yl] tridecanoate;molecular hydrogen;S-tetradeca-1,3,5,7,9,11,13-heptaynyl ethanethioate |
| SMILES | C#CC#CC#CC#CC#CC#CC#CSC(C)=O.CCCCCCCCCCCCC(=O)O[C@H](CO)COCO.[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H].[H][H] |
| InChI | InChI=1S/C17H34O5.C16H4OS.11H2/c1-2-3-4-5-6-7-8-9-10-11-12-17(20)22-16(13-18)14-21-15-19;1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17;;;;;;;;;;;/h16,18-19H,2-15H2,1H3;1H,2H3;11*1H/t16-;;;;;;;;;;;;/m1............/s1 |
| InChIKey | NUHIISJRFNKBIU-JPLJSMPXSA-N |
| XLogP | 6.75 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.90 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|