C24H35BN8O2 — CID 159893413
3-methyl-5-(1-methylpyrazol-3-yl)pyridine;1-methylpyrazol-3-amine;1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 159893413) has the molecular formula C24H35BN8O2 and a molecular weight of 478.41 g/mol. Its IUPAC name is 3-methyl-5-(1-methylpyrazol-3-yl)pyridine;1-methylpyrazol-3-amine;1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 3-methyl-5-(1-methylpyrazol-3-yl)pyridine;1-methylpyrazol-3-amine;1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 159893413 |
| Molecular Formula | C24H35BN8O2 |
| Molecular Weight | 478.41 g/mol |
| Exact Mass | 478.30 |
| IUPAC Name | 3-methyl-5-(1-methylpyrazol-3-yl)pyridine;1-methylpyrazol-3-amine;1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | Cc1cncc(-c2ccn(C)n2)c1.Cn1ccc(B2OC(C)(C)C(C)(C)O2)n1.Cn1ccc(N)n1 |
| InChI | InChI=1S/C10H17BN2O2.C10H11N3.C4H7N3/c1-9(2)10(3,4)15-11(14-9)8-6-7-13(5)12-8;1-8-5-9(7-11-6-8)10-3-4-13(2)12-10;1-7-3-2-4(5)6-7/h6-7H,1-5H3;3-7H,1-2H3;2-3H,1H3,(H2,5,6) |
| InChIKey | NVAVTDHRDLJWKX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 110.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|