C22H22Cl2N2O3S — CID 15989345
3-(3,4-dichlorophenyl)-1-(3,3-dimethyl-2-oxobutyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2,4-dione (PubChem CID 15989345) has the molecular formula C22H22Cl2N2O3S and a molecular weight of 465.40 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-(3,3-dimethyl-2-oxobutyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 3-(3,4-dichlorophenyl)-1-(3,3-dimethyl-2-oxobutyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 15989345 |
| Molecular Formula | C22H22Cl2N2O3S |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-(3,3-dimethyl-2-oxobutyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)C(=O)Cn1c(=O)n(-c2ccc(Cl)c(Cl)c2)c(=O)c2c3c(sc21)CCCC3 |
| InChI | InChI=1S/C22H22Cl2N2O3S/c1-22(2,3)17(27)11-25-20-18(13-6-4-5-7-16(13)30-20)19(28)26(21(25)29)12-8-9-14(23)15(24)10-12/h8-10H,4-7,11H2,1-3H3 |
| InChIKey | HFCOJTIVSYSJCA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |