About 4-(2-bromoacetyl)benzoic acid;formamide;4-(1H-imidazol-5-yl)benzoic acid
4-(2-bromoacetyl)benzoic acid;formamide;4-(1H-imidazol-5-yl)benzoic acid (PubChem CID 159894675) has the molecular formula C20H18BrN3O6
and a molecular weight of 476.28 g/mol. Its IUPAC name is 4-(2-bromoacetyl)benzoic acid;formamide;4-(1H-imidazol-5-yl)benzoic acid.
Molecular Properties
| Compound Name | 4-(2-bromoacetyl)benzoic acid;formamide;4-(1H-imidazol-5-yl)benzoic acid |
| PubChem CID | 159894675 |
| Molecular Formula | C20H18BrN3O6 |
| Molecular Weight | 476.28 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | 4-(2-bromoacetyl)benzoic acid;formamide;4-(1H-imidazol-5-yl)benzoic acid |
| SMILES | NC=O.O=C(O)c1ccc(-c2cnc[nH]2)cc1.O=C(O)c1ccc(C(=O)CBr)cc1 |
| InChI | InChI=1S/C10H8N2O2.C9H7BrO3.CH3NO/c13-10(14)8-3-1-7(2-4-8)9-5-11-6-12-9;10-5-8(11)6-1-3-7(4-2-6)9(12)13;2-1-3/h1-6H,(H,11,12)(H,13,14);1-4H,5H2,(H,12,13);1H,(H2,2,3) |
| InChIKey | NVEPBYGARQOPFD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 163.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-bromoacetyl)benzoic acid;formamide;4-(1H-imidazol-5-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-bromoacetyl)benzoic acid;formamide;4-(1H-imidazol-5-yl)benzoic acid?
The IUPAC name of 4-(2-bromoacetyl)benzoic acid;formamide;4-(1H-imidazol-5-yl)benzoic acid (CID 159894675) is 4-(2-bromoacetyl)benzoic acid;formamide;4-(1H-imidazol-5-yl)benzoic acid.
What is the SMILES notation for 4-(2-bromoacetyl)benzoic acid;formamide;4-(1H-imidazol-5-yl)benzoic acid?
The canonical SMILES for 4-(2-bromoacetyl)benzoic acid;formamide;4-(1H-imidazol-5-yl)benzoic acid is NC=O.O=C(O)c1ccc(-c2cnc[nH]2)cc1.O=C(O)c1ccc(C(=O)CBr)cc1.
What is the InChIKey of 4-(2-bromoacetyl)benzoic acid;formamide;4-(1H-imidazol-5-yl)benzoic acid?
The InChIKey is NVEPBYGARQOPFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2.C9H7BrO3.CH3NO/c13-10(14)8-3-1-7(2-4-8)9-5-11-6-12-9;10-5-8(11)6-1-3-7(4-2-6)9(12)13;2-1-3/h1-6H,(H,11,12)(H,13,14);1-4H,5H2,(H,12,13);1H,(H2,2,3).
What are the key properties of 4-(2-bromoacetyl)benzoic acid;formamide;4-(1H-imidazol-5-yl)benzoic acid?
4-(2-bromoacetyl)benzoic acid;formamide;4-(1H-imidazol-5-yl)benzoic acid has a molecular weight of 476.28 g/mol, XLogP of 2.84, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bromoacetyl)benzoic acid;formamide;4-(1H-imidazol-5-yl)benzoic acid is sourced from PubChem (CID 159894675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).