C21H18N2O4 — CID 19422018
4-[(E)-4-(4-carboxyphenyl)-4-(1H-imidazol-5-yl)but-3-enyl]benzoic acid (PubChem CID 19422018) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is 4-[(E)-4-(4-carboxyphenyl)-4-(1H-imidazol-5-yl)but-3-enyl]benzoic acid.
| Compound Name | 4-[(E)-4-(4-carboxyphenyl)-4-(1H-imidazol-5-yl)but-3-enyl]benzoic acid |
|---|---|
| PubChem CID | 19422018 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 4-[(E)-4-(4-carboxyphenyl)-4-(1H-imidazol-5-yl)but-3-enyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CC/C=C(\c2ccc(C(=O)O)cc2)c2cnc[nH]2)cc1 |
| InChI | InChI=1S/C21H18N2O4/c24-20(25)16-6-4-14(5-7-16)2-1-3-18(19-12-22-13-23-19)15-8-10-17(11-9-15)21(26)27/h3-13H,1-2H2,(H,22,23)(H,24,25)(H,26,27)/b18-3+ |
| InChIKey | UMLBUSXGDLPYJJ-JFQJCAQQSA-N |
| XLogP | 3.87 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |