C17H14N2 — CID 76703178
5-(1,2-diphenylethenyl)-1H-imidazole (PubChem CID 76703178) has the molecular formula C17H14N2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 5-(1,2-diphenylethenyl)-1H-imidazole.
| Compound Name | 5-(1,2-diphenylethenyl)-1H-imidazole |
|---|---|
| PubChem CID | 76703178 |
| Molecular Formula | C17H14N2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 5-(1,2-diphenylethenyl)-1H-imidazole |
| SMILES | C(=C(c1ccccc1)c1cnc[nH]1)c1ccccc1 |
| InChI | InChI=1S/C17H14N2/c1-3-7-14(8-4-1)11-16(17-12-18-13-19-17)15-9-5-2-6-10-15/h1-13H,(H,18,19) |
| InChIKey | VEVXKWPCQINBNL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|