C12H13ClN4OS — CID 15989481
1-(2-chlorophenyl)-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 15989481) has the molecular formula C12H13ClN4OS and a molecular weight of 296.78 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-(2-chlorophenyl)-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 15989481 |
| Molecular Formula | C12H13ClN4OS |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 1-(2-chlorophenyl)-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CCCc1nnc(NC(=O)Nc2ccccc2Cl)s1 |
| InChI | InChI=1S/C12H13ClN4OS/c1-2-5-10-16-17-12(19-10)15-11(18)14-9-7-4-3-6-8(9)13/h3-4,6-7H,2,5H2,1H3,(H2,14,15,17,18) |
| InChIKey | SFNBACVZMZSDHA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |