C20H22N4O2 — CID 15989506
1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(2-ethylphenyl)urea (PubChem CID 15989506) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(2-ethylphenyl)urea.
| Compound Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(2-ethylphenyl)urea |
|---|---|
| PubChem CID | 15989506 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(2-ethylphenyl)urea |
| SMILES | CCc1ccccc1NC(=O)Nc1c(C)n(C)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C20H22N4O2/c1-4-15-10-8-9-13-17(15)21-20(26)22-18-14(2)23(3)24(19(18)25)16-11-6-5-7-12-16/h5-13H,4H2,1-3H3,(H2,21,22,26) |
| InChIKey | GEASTAWEGIFMGD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |