C26H31N3O4 — CID 159896853
methanol;3-methoxy-5,6,7-trimethylquinoline;5,6,7-trimethyl-3-nitroquinoline (PubChem CID 159896853) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is methanol;3-methoxy-5,6,7-trimethylquinoline;5,6,7-trimethyl-3-nitroquinoline.
| Compound Name | methanol;3-methoxy-5,6,7-trimethylquinoline;5,6,7-trimethyl-3-nitroquinoline |
|---|---|
| PubChem CID | 159896853 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | methanol;3-methoxy-5,6,7-trimethylquinoline;5,6,7-trimethyl-3-nitroquinoline |
| SMILES | CO.COc1cnc2cc(C)c(C)c(C)c2c1.Cc1cc2ncc([N+](=O)[O-])cc2c(C)c1C |
| InChI | InChI=1S/C13H15NO.C12H12N2O2.CH4O/c1-8-5-13-12(10(3)9(8)2)6-11(15-4)7-14-13;1-7-4-12-11(9(3)8(7)2)5-10(6-13-12)14(15)16;1-2/h5-7H,1-4H3;4-6H,1-3H3;2H,1H3 |
| InChIKey | NVLKRBOVXJSLFV-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|