C15H13N3O4 — CID 66646438
(5-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3-nitrophenyl)methanol (PubChem CID 66646438) has the molecular formula C15H13N3O4 and a molecular weight of 299.29 g/mol. Its IUPAC name is (5-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3-nitrophenyl)methanol.
| Compound Name | (5-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3-nitrophenyl)methanol |
|---|---|
| PubChem CID | 66646438 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (5-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)-(3-nitrophenyl)methanol |
| SMILES | COc1cnc2[nH]cc(C(O)c3cccc([N+](=O)[O-])c3)c2c1 |
| InChI | InChI=1S/C15H13N3O4/c1-22-11-6-12-13(8-17-15(12)16-7-11)14(19)9-3-2-4-10(5-9)18(20)21/h2-8,14,19H,1H3,(H,16,17) |
| InChIKey | OFTSKQRYCPSPJI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|