About 2-(4-hydroxyphenyl)-2-(3-methoxyphenyl)propanoic acid;methyl acetate
2-(4-hydroxyphenyl)-2-(3-methoxyphenyl)propanoic acid;methyl acetate (PubChem CID 159897178) has the molecular formula C19H22O6
and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-2-(3-methoxyphenyl)propanoic acid;methyl acetate.
Molecular Properties
| Compound Name | 2-(4-hydroxyphenyl)-2-(3-methoxyphenyl)propanoic acid;methyl acetate |
| PubChem CID | 159897178 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-(4-hydroxyphenyl)-2-(3-methoxyphenyl)propanoic acid;methyl acetate |
| SMILES | COC(C)=O.COc1cccc(C(C)(C(=O)O)c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C16H16O4.C3H6O2/c1-16(15(18)19,11-6-8-13(17)9-7-11)12-4-3-5-14(10-12)20-2;1-3(4)5-2/h3-10,17H,1-2H3,(H,18,19);1-2H3 |
| InChIKey | NVMLLTCWJUDDTA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-hydroxyphenyl)-2-(3-methoxyphenyl)propanoic acid;methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxyphenyl)-2-(3-methoxyphenyl)propanoic acid;methyl acetate?
The IUPAC name of 2-(4-hydroxyphenyl)-2-(3-methoxyphenyl)propanoic acid;methyl acetate (CID 159897178) is 2-(4-hydroxyphenyl)-2-(3-methoxyphenyl)propanoic acid;methyl acetate.
What is the SMILES notation for 2-(4-hydroxyphenyl)-2-(3-methoxyphenyl)propanoic acid;methyl acetate?
The canonical SMILES for 2-(4-hydroxyphenyl)-2-(3-methoxyphenyl)propanoic acid;methyl acetate is COC(C)=O.COc1cccc(C(C)(C(=O)O)c2ccc(O)cc2)c1.
What is the InChIKey of 2-(4-hydroxyphenyl)-2-(3-methoxyphenyl)propanoic acid;methyl acetate?
The InChIKey is NVMLLTCWJUDDTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O4.C3H6O2/c1-16(15(18)19,11-6-8-13(17)9-7-11)12-4-3-5-14(10-12)20-2;1-3(4)5-2/h3-10,17H,1-2H3,(H,18,19);1-2H3.
What are the key properties of 2-(4-hydroxyphenyl)-2-(3-methoxyphenyl)propanoic acid;methyl acetate?
2-(4-hydroxyphenyl)-2-(3-methoxyphenyl)propanoic acid;methyl acetate has a molecular weight of 346.38 g/mol, XLogP of 2.97, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxyphenyl)-2-(3-methoxyphenyl)propanoic acid;methyl acetate is sourced from PubChem (CID 159897178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).