C24H20ClFN2O3S — CID 15990772
5-[(2-chloro-6-fluorophenyl)methyl]-N-(2-methoxyethyl)-6-oxobenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 15990772) has the molecular formula C24H20ClFN2O3S and a molecular weight of 470.95 g/mol. Its IUPAC name is 5-[(2-chloro-6-fluorophenyl)methyl]-N-(2-methoxyethyl)-6-oxobenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | 5-[(2-chloro-6-fluorophenyl)methyl]-N-(2-methoxyethyl)-6-oxobenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 15990772 |
| Molecular Formula | C24H20ClFN2O3S |
| Molecular Weight | 470.95 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 5-[(2-chloro-6-fluorophenyl)methyl]-N-(2-methoxyethyl)-6-oxobenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | COCCNC(=O)c1ccc2c(c1)N(Cc1c(F)cccc1Cl)C(=O)c1ccccc1S2 |
| InChI | InChI=1S/C24H20ClFN2O3S/c1-31-12-11-27-23(29)15-9-10-22-20(13-15)28(14-17-18(25)6-4-7-19(17)26)24(30)16-5-2-3-8-21(16)32-22/h2-10,13H,11-12,14H2,1H3,(H,27,29) |
| InChIKey | SDWKBPXGTGXWKB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.95 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|