C27H27ClN2O3S — CID 5204289
5-[(2-chlorophenyl)methyl]-6-oxo-N-(3-propan-2-yloxypropyl)benzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 5204289) has the molecular formula C27H27ClN2O3S and a molecular weight of 495.04 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)methyl]-6-oxo-N-(3-propan-2-yloxypropyl)benzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | 5-[(2-chlorophenyl)methyl]-6-oxo-N-(3-propan-2-yloxypropyl)benzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 5204289 |
| Molecular Formula | C27H27ClN2O3S |
| Molecular Weight | 495.04 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 5-[(2-chlorophenyl)methyl]-6-oxo-N-(3-propan-2-yloxypropyl)benzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CC(C)OCCCNC(=O)c1ccc2c(c1)N(Cc1ccccc1Cl)C(=O)c1ccccc1S2 |
| InChI | InChI=1S/C27H27ClN2O3S/c1-18(2)33-15-7-14-29-26(31)19-12-13-25-23(16-19)30(17-20-8-3-5-10-22(20)28)27(32)21-9-4-6-11-24(21)34-25/h3-6,8-13,16,18H,7,14-15,17H2,1-2H3,(H,29,31) |
| InChIKey | RXRZVHUDFPJBCM-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.04 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|