C12H20N4O2 — CID 159910237
1,5-dimethylpiperazin-2-one;1,5-dimethylpyrazin-2-one (PubChem CID 159910237) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is 1,5-dimethylpiperazin-2-one;1,5-dimethylpyrazin-2-one.
| Compound Name | 1,5-dimethylpiperazin-2-one;1,5-dimethylpyrazin-2-one |
|---|---|
| PubChem CID | 159910237 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 1,5-dimethylpiperazin-2-one;1,5-dimethylpyrazin-2-one |
| SMILES | CC1CN(C)C(=O)CN1.Cc1cn(C)c(=O)cn1 |
| InChI | InChI=1S/C6H12N2O.C6H8N2O/c2*1-5-4-8(2)6(9)3-7-5/h5,7H,3-4H2,1-2H3;3-4H,1-2H3 |
| InChIKey | NXCBLRUPWNRJFL-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |