C24H27N5O2S — CID 15991457
N-(4-acetamidophenyl)-2-[3-(4-methylpiperidin-1-yl)quinoxalin-2-yl]sulfanylacetamide (PubChem CID 15991457) has the molecular formula C24H27N5O2S and a molecular weight of 449.58 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-[3-(4-methylpiperidin-1-yl)quinoxalin-2-yl]sulfanylacetamide.
| Compound Name | N-(4-acetamidophenyl)-2-[3-(4-methylpiperidin-1-yl)quinoxalin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 15991457 |
| Molecular Formula | C24H27N5O2S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | N-(4-acetamidophenyl)-2-[3-(4-methylpiperidin-1-yl)quinoxalin-2-yl]sulfanylacetamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)CSc2nc3ccccc3nc2N2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C24H27N5O2S/c1-16-11-13-29(14-12-16)23-24(28-21-6-4-3-5-20(21)27-23)32-15-22(31)26-19-9-7-18(8-10-19)25-17(2)30/h3-10,16H,11-15H2,1-2H3,(H,25,30)(H,26,31) |
| InChIKey | LYQFPSVRAQCCSU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |