C23H26N4OS — CID 22332533
N-(4-propan-2-ylphenyl)-2-(3-pyrrolidin-1-ylquinoxalin-2-yl)sulfanylacetamide (PubChem CID 22332533) has the molecular formula C23H26N4OS and a molecular weight of 406.56 g/mol. Its IUPAC name is N-(4-propan-2-ylphenyl)-2-(3-pyrrolidin-1-ylquinoxalin-2-yl)sulfanylacetamide.
| Compound Name | N-(4-propan-2-ylphenyl)-2-(3-pyrrolidin-1-ylquinoxalin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 22332533 |
| Molecular Formula | C23H26N4OS |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | N-(4-propan-2-ylphenyl)-2-(3-pyrrolidin-1-ylquinoxalin-2-yl)sulfanylacetamide |
| SMILES | CC(C)c1ccc(NC(=O)CSc2nc3ccccc3nc2N2CCCC2)cc1 |
| InChI | InChI=1S/C23H26N4OS/c1-16(2)17-9-11-18(12-10-17)24-21(28)15-29-23-22(27-13-5-6-14-27)25-19-7-3-4-8-20(19)26-23/h3-4,7-12,16H,5-6,13-15H2,1-2H3,(H,24,28) |
| InChIKey | LSAVYSHQZNZNIP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |