C21H21FN4OS — CID 22332549
N-[(4-fluorophenyl)methyl]-2-(3-pyrrolidin-1-ylquinoxalin-2-yl)sulfanylacetamide (PubChem CID 22332549) has the molecular formula C21H21FN4OS and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-(3-pyrrolidin-1-ylquinoxalin-2-yl)sulfanylacetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-(3-pyrrolidin-1-ylquinoxalin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 22332549 |
| Molecular Formula | C21H21FN4OS |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-(3-pyrrolidin-1-ylquinoxalin-2-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nc2ccccc2nc1N1CCCC1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H21FN4OS/c22-16-9-7-15(8-10-16)13-23-19(27)14-28-21-20(26-11-3-4-12-26)24-17-5-1-2-6-18(17)25-21/h1-2,5-10H,3-4,11-14H2,(H,23,27) |
| InChIKey | XJLQWGBRSZDTQY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |